C18H18O — CID 143269279
2-[(3E,5Z)-octa-1,3,5-trien-4-yl]oxynaphthalene (PubChem CID 143269279) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[(3E,5Z)-octa-1,3,5-trien-4-yl]oxynaphthalene.
| Compound Name | 2-[(3E,5Z)-octa-1,3,5-trien-4-yl]oxynaphthalene |
|---|---|
| PubChem CID | 143269279 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-[(3E,5Z)-octa-1,3,5-trien-4-yl]oxynaphthalene |
| SMILES | C=C/C=C(\C=C/CC)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H18O/c1-3-5-11-17(8-4-2)19-18-13-12-15-9-6-7-10-16(15)14-18/h4-14H,2-3H2,1H3/b11-5-,17-8+ |
| InChIKey | WRFZGHLPAAAABJ-JDCPZMFTSA-N |
| XLogP | 5.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|