C23H32O2 — CID 142063297
ethane;1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-3-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene (PubChem CID 142063297) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is ethane;1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-3-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene.
| Compound Name | ethane;1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-3-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene |
|---|---|
| PubChem CID | 142063297 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | ethane;1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-3-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene |
| SMILES | C=C/C=C\C(=C/C)Oc1cccc(O/C(C=C)=C/C=C)c1.CC.CC |
| InChI | InChI=1S/C19H20O2.2C2H6/c1-5-9-12-17(8-4)21-19-14-10-13-18(15-19)20-16(7-3)11-6-2;2*1-2/h5-15H,1-3H2,4H3;2*1-2H3/b12-9-,16-11+,17-8+;; |
| InChIKey | QPOTZAKWFAAAPJ-LOOVDFPQSA-N |
| XLogP | 7.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|