C13H17NO — CID 142985984
(1Z,3E)-N-methyl-3-(3-methylphenoxy)penta-1,3-dien-1-amine (PubChem CID 142985984) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is (1Z,3E)-N-methyl-3-(3-methylphenoxy)penta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-N-methyl-3-(3-methylphenoxy)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142985984 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (1Z,3E)-N-methyl-3-(3-methylphenoxy)penta-1,3-dien-1-amine |
| SMILES | C/C=C(\C=C/NC)Oc1cccc(C)c1 |
| InChI | InChI=1S/C13H17NO/c1-4-12(8-9-14-3)15-13-7-5-6-11(2)10-13/h4-10,14H,1-3H3/b9-8-,12-4+ |
| InChIKey | IFDJEOIPEMASSI-FIYMPXMFSA-N |
| XLogP | 3.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|