C12H15NO — CID 142867321
3-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyaniline (PubChem CID 142867321) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyaniline.
| Compound Name | 3-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyaniline |
|---|---|
| PubChem CID | 142867321 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyaniline |
| SMILES | C/C=C\C(=C/C)Oc1cccc(N)c1 |
| InChI | InChI=1S/C12H15NO/c1-3-6-11(4-2)14-12-8-5-7-10(13)9-12/h3-9H,13H2,1-2H3/b6-3-,11-4+ |
| InChIKey | REYQXLFQWBOBHM-WVVGTSEZSA-N |
| XLogP | 3.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|