C14H18O — CID 142857117
ethene;1-methyl-3-[(3Z)-penta-1,3-dien-2-yl]oxybenzene (PubChem CID 142857117) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is ethene;1-methyl-3-[(3Z)-penta-1,3-dien-2-yl]oxybenzene.
| Compound Name | ethene;1-methyl-3-[(3Z)-penta-1,3-dien-2-yl]oxybenzene |
|---|---|
| PubChem CID | 142857117 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | ethene;1-methyl-3-[(3Z)-penta-1,3-dien-2-yl]oxybenzene |
| SMILES | C=C.C=C(/C=C\C)Oc1cccc(C)c1 |
| InChI | InChI=1S/C12H14O.C2H4/c1-4-6-11(3)13-12-8-5-7-10(2)9-12;1-2/h4-9H,3H2,1-2H3;1-2H2/b6-4-; |
| InChIKey | KRIPMBXNWMESDI-YHSAGPEESA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|