C18H18O — CID 135062070
1-methyl-3-[(1E)-1-phenylpenta-1,4-dienoxy]benzene (PubChem CID 135062070) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-methyl-3-[(1E)-1-phenylpenta-1,4-dienoxy]benzene.
| Compound Name | 1-methyl-3-[(1E)-1-phenylpenta-1,4-dienoxy]benzene |
|---|---|
| PubChem CID | 135062070 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-methyl-3-[(1E)-1-phenylpenta-1,4-dienoxy]benzene |
| SMILES | C=CC/C=C(/Oc1cccc(C)c1)c1ccccc1 |
| InChI | InChI=1S/C18H18O/c1-3-4-13-18(16-10-6-5-7-11-16)19-17-12-8-9-15(2)14-17/h3,5-14H,1,4H2,2H3/b18-13+ |
| InChIKey | RZIITIOBQIIFGK-QGOAFFKASA-N |
| XLogP | 4.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|