C13H18 — CID 173131413
penta-1,4-diene;1,3-xylene (PubChem CID 173131413) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is penta-1,4-diene;1,3-xylene.
| Compound Name | penta-1,4-diene;1,3-xylene |
|---|---|
| PubChem CID | 173131413 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | penta-1,4-diene;1,3-xylene |
| SMILES | C=CCC=C.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H10.C5H8/c1-7-4-3-5-8(2)6-7;1-3-5-4-2/h3-6H,1-2H3;3-4H,1-2,5H2 |
| InChIKey | QNCVAHOMOGUZJG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|