C13H14N2O2 — CID 142007343
(2Z)-2-(methylideneamino)-4-(3-methylphenoxy)penta-2,4-dienamide (PubChem CID 142007343) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is (2Z)-2-(methylideneamino)-4-(3-methylphenoxy)penta-2,4-dienamide.
| Compound Name | (2Z)-2-(methylideneamino)-4-(3-methylphenoxy)penta-2,4-dienamide |
|---|---|
| PubChem CID | 142007343 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (2Z)-2-(methylideneamino)-4-(3-methylphenoxy)penta-2,4-dienamide |
| SMILES | C=N/C(=C\C(=C)Oc1cccc(C)c1)C(N)=O |
| InChI | InChI=1S/C13H14N2O2/c1-9-5-4-6-11(7-9)17-10(2)8-12(15-3)13(14)16/h4-8H,2-3H2,1H3,(H2,14,16)/b12-8- |
| InChIKey | FEORUSCVJIQWOB-WQLSENKSSA-N |
| XLogP | 1.96 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|