C13H17NO — CID 146419743
4-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-2,6-dimethylpyridine (PubChem CID 146419743) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 4-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-2,6-dimethylpyridine.
| Compound Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-2,6-dimethylpyridine |
|---|---|
| PubChem CID | 146419743 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-2,6-dimethylpyridine |
| SMILES | C/C=C\C(=C/C)Oc1cc(C)nc(C)c1 |
| InChI | InChI=1S/C13H17NO/c1-5-7-12(6-2)15-13-8-10(3)14-11(4)9-13/h5-9H,1-4H3/b7-5-,12-6+ |
| InChIKey | VAENRAMFMVQADO-NFWBANDSSA-N |
| XLogP | 3.56 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|