C22H23F3O2 — CID 154531957
1-methyl-3-[(1E,3E)-3-(3-methylphenoxy)-1-[(2S)-1,1,1-trifluoropropan-2-yl]penta-1,3-dienoxy]benzene (PubChem CID 154531957) has the molecular formula C22H23F3O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 1-methyl-3-[(1E,3E)-3-(3-methylphenoxy)-1-[(2S)-1,1,1-trifluoropropan-2-yl]penta-1,3-dienoxy]benzene.
| Compound Name | 1-methyl-3-[(1E,3E)-3-(3-methylphenoxy)-1-[(2S)-1,1,1-trifluoropropan-2-yl]penta-1,3-dienoxy]benzene |
|---|---|
| PubChem CID | 154531957 |
| Molecular Formula | C22H23F3O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-methyl-3-[(1E,3E)-3-(3-methylphenoxy)-1-[(2S)-1,1,1-trifluoropropan-2-yl]penta-1,3-dienoxy]benzene |
| SMILES | C/C=C(\C=C(\Oc1cccc(C)c1)[C@H](C)C(F)(F)F)Oc1cccc(C)c1 |
| InChI | InChI=1S/C22H23F3O2/c1-5-18(26-19-10-6-8-15(2)12-19)14-21(17(4)22(23,24)25)27-20-11-7-9-16(3)13-20/h5-14,17H,1-4H3/b18-5+,21-14+/t17-/m0/s1 |
| InChIKey | QMJOGYILTKOOHA-JVSQDXIDSA-N |
| XLogP | 6.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|