C16H22O — CID 144940147
ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene (PubChem CID 144940147) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene.
| Compound Name | ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene |
|---|---|
| PubChem CID | 144940147 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene |
| SMILES | C=C/C=C(\C=C)Oc1ccc(CC)cc1.CC |
| InChI | InChI=1S/C14H16O.C2H6/c1-4-7-13(6-3)15-14-10-8-12(5-2)9-11-14;1-2/h4,6-11H,1,3,5H2,2H3;1-2H3/b13-7+; |
| InChIKey | JHXTYHKIFQGNOK-FTPOTTDRSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|