About ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene
ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene (PubChem CID 144940147) has the molecular formula C16H22O
and a molecular weight of 230.35 g/mol. Its IUPAC name is ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene |
| PubChem CID | 144940147 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene |
| SMILES | C=C/C=C(\C=C)Oc1ccc(CC)cc1.CC |
| InChI | InChI=1S/C14H16O.C2H6/c1-4-7-13(6-3)15-14-10-8-12(5-2)9-11-14;1-2/h4,6-11H,1,3,5H2,2H3;1-2H3/b13-7+; |
| InChIKey | JHXTYHKIFQGNOK-FTPOTTDRSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene?
The IUPAC name of ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene (CID 144940147) is ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene.
What is the SMILES notation for ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene?
The canonical SMILES for ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene is C=C/C=C(\C=C)Oc1ccc(CC)cc1.CC.
What is the InChIKey of ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene?
The InChIKey is JHXTYHKIFQGNOK-FTPOTTDRSA-N. The full InChI is InChI=1S/C14H16O.C2H6/c1-4-7-13(6-3)15-14-10-8-12(5-2)9-11-14;1-2/h4,6-11H,1,3,5H2,2H3;1-2H3/b13-7+;.
What are the key properties of ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene?
ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene has a molecular weight of 230.35 g/mol, XLogP of 4.91, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene is sourced from PubChem (CID 144940147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).