C24H29ClN2O2 — CID 143856590
(2Z,3Z)-2-(1-aminoethylidene)-5-chloro-N-[[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]methyl]-6-methylocta-3,5-dienamide (PubChem CID 143856590) has the molecular formula C24H29ClN2O2 and a molecular weight of 412.96 g/mol. Its IUPAC name is (2Z,3Z)-2-(1-aminoethylidene)-5-chloro-N-[[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]methyl]-6-methylocta-3,5-dienamide.
| Compound Name | (2Z,3Z)-2-(1-aminoethylidene)-5-chloro-N-[[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]methyl]-6-methylocta-3,5-dienamide |
|---|---|
| PubChem CID | 143856590 |
| Molecular Formula | C24H29ClN2O2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (2Z,3Z)-2-(1-aminoethylidene)-5-chloro-N-[[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]methyl]-6-methylocta-3,5-dienamide |
| SMILES | C=C/C=C(\C=C)Oc1ccc(CNC(=O)C(/C=C\C(Cl)=C(C)CC)=C(/C)N)cc1 |
| InChI | InChI=1S/C24H29ClN2O2/c1-6-9-20(8-3)29-21-12-10-19(11-13-21)16-27-24(28)22(18(5)26)14-15-23(25)17(4)7-2/h6,8-15H,1,3,7,16,26H2,2,4-5H3,(H,27,28)/b15-14-,20-9+,22-18-,23-17? |
| InChIKey | SVUUAGMNAHHUNZ-BFNIZERRSA-N |
| XLogP | 5.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|