C25H26ClF3N2O2 — CID 143856475
(2Z,3Z)-2-(1-aminoethylidene)-N-[[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]methyl]-6-methylocta-3,5-dienamide (PubChem CID 143856475) has the molecular formula C25H26ClF3N2O2 and a molecular weight of 478.94 g/mol. Its IUPAC name is (2Z,3Z)-2-(1-aminoethylidene)-N-[[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]methyl]-6-methylocta-3,5-dienamide.
| Compound Name | (2Z,3Z)-2-(1-aminoethylidene)-N-[[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]methyl]-6-methylocta-3,5-dienamide |
|---|---|
| PubChem CID | 143856475 |
| Molecular Formula | C25H26ClF3N2O2 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | (2Z,3Z)-2-(1-aminoethylidene)-N-[[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]methyl]-6-methylocta-3,5-dienamide |
| SMILES | CCC(C)=C/C=C\C(C(=O)NCc1ccc(Oc2ccc(C(F)(F)F)cc2Cl)cc1)=C(/C)N |
| InChI | InChI=1S/C25H26ClF3N2O2/c1-4-16(2)6-5-7-21(17(3)30)24(32)31-15-18-8-11-20(12-9-18)33-23-13-10-19(14-22(23)26)25(27,28)29/h5-14H,4,15,30H2,1-3H3,(H,31,32)/b7-5-,16-6?,21-17- |
| InChIKey | LRNYAEOEZMJXPI-BTZGRMKJSA-N |
| XLogP | 6.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|