C24H27FN2O2 — CID 143856448
(2Z,3Z)-2-(1-aminoethylidene)-N-[[3-(4-fluorophenoxy)phenyl]methyl]-6-methylocta-3,5-dienamide (PubChem CID 143856448) has the molecular formula C24H27FN2O2 and a molecular weight of 394.49 g/mol. Its IUPAC name is (2Z,3Z)-2-(1-aminoethylidene)-N-[[3-(4-fluorophenoxy)phenyl]methyl]-6-methylocta-3,5-dienamide.
| Compound Name | (2Z,3Z)-2-(1-aminoethylidene)-N-[[3-(4-fluorophenoxy)phenyl]methyl]-6-methylocta-3,5-dienamide |
|---|---|
| PubChem CID | 143856448 |
| Molecular Formula | C24H27FN2O2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (2Z,3Z)-2-(1-aminoethylidene)-N-[[3-(4-fluorophenoxy)phenyl]methyl]-6-methylocta-3,5-dienamide |
| SMILES | CCC(C)=C/C=C\C(C(=O)NCc1cccc(Oc2ccc(F)cc2)c1)=C(/C)N |
| InChI | InChI=1S/C24H27FN2O2/c1-4-17(2)7-5-10-23(18(3)26)24(28)27-16-19-8-6-9-22(15-19)29-21-13-11-20(25)12-14-21/h5-15H,4,16,26H2,1-3H3,(H,27,28)/b10-5-,17-7?,23-18- |
| InChIKey | VVJRMSZDYOIFMW-WDUYMGOPSA-N |
| XLogP | 5.38 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|