C21H22F2N2O2 — CID 89148132
(Z,2Z)-2-(1-aminoethylidene)-5-fluoro-N-[[3-(2-fluorophenoxy)phenyl]methyl]hex-3-enamide (PubChem CID 89148132) has the molecular formula C21H22F2N2O2 and a molecular weight of 372.42 g/mol. Its IUPAC name is (Z,2Z)-2-(1-aminoethylidene)-5-fluoro-N-[[3-(2-fluorophenoxy)phenyl]methyl]hex-3-enamide.
| Compound Name | (Z,2Z)-2-(1-aminoethylidene)-5-fluoro-N-[[3-(2-fluorophenoxy)phenyl]methyl]hex-3-enamide |
|---|---|
| PubChem CID | 89148132 |
| Molecular Formula | C21H22F2N2O2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (Z,2Z)-2-(1-aminoethylidene)-5-fluoro-N-[[3-(2-fluorophenoxy)phenyl]methyl]hex-3-enamide |
| SMILES | C/C(N)=C(\C=C/C(C)F)C(=O)NCc1cccc(Oc2ccccc2F)c1 |
| InChI | InChI=1S/C21H22F2N2O2/c1-14(22)10-11-18(15(2)24)21(26)25-13-16-6-5-7-17(12-16)27-20-9-4-3-8-19(20)23/h3-12,14H,13,24H2,1-2H3,(H,25,26)/b11-10-,18-15- |
| InChIKey | NNCKUWFNCLUPQV-KBMNNFSISA-N |
| XLogP | 4.38 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|