C21H23FN2O2 — CID 89148090
(Z,2Z)-2-(1-aminoethylidene)-N-[(2-fluoro-5-phenoxyphenyl)methyl]hex-3-enamide (PubChem CID 89148090) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is (Z,2Z)-2-(1-aminoethylidene)-N-[(2-fluoro-5-phenoxyphenyl)methyl]hex-3-enamide.
| Compound Name | (Z,2Z)-2-(1-aminoethylidene)-N-[(2-fluoro-5-phenoxyphenyl)methyl]hex-3-enamide |
|---|---|
| PubChem CID | 89148090 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (Z,2Z)-2-(1-aminoethylidene)-N-[(2-fluoro-5-phenoxyphenyl)methyl]hex-3-enamide |
| SMILES | CC/C=C\C(C(=O)NCc1cc(Oc2ccccc2)ccc1F)=C(/C)N |
| InChI | InChI=1S/C21H23FN2O2/c1-3-4-10-19(15(2)23)21(25)24-14-16-13-18(11-12-20(16)22)26-17-8-6-5-7-9-17/h4-13H,3,14,23H2,1-2H3,(H,24,25)/b10-4-,19-15- |
| InChIKey | QBZXFZKKADKDOB-DGCXUEKOSA-N |
| XLogP | 4.43 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|