C22H25FN2O3 — CID 89148232
(Z,2Z)-2-(1-aminoethylidene)-5-fluoro-N-[[3-(2-methoxyphenoxy)phenyl]methyl]hex-3-enamide (PubChem CID 89148232) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is (Z,2Z)-2-(1-aminoethylidene)-5-fluoro-N-[[3-(2-methoxyphenoxy)phenyl]methyl]hex-3-enamide.
| Compound Name | (Z,2Z)-2-(1-aminoethylidene)-5-fluoro-N-[[3-(2-methoxyphenoxy)phenyl]methyl]hex-3-enamide |
|---|---|
| PubChem CID | 89148232 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (Z,2Z)-2-(1-aminoethylidene)-5-fluoro-N-[[3-(2-methoxyphenoxy)phenyl]methyl]hex-3-enamide |
| SMILES | COc1ccccc1Oc1cccc(CNC(=O)C(/C=C\C(C)F)=C(/C)N)c1 |
| InChI | InChI=1S/C22H25FN2O3/c1-15(23)11-12-19(16(2)24)22(26)25-14-17-7-6-8-18(13-17)28-21-10-5-4-9-20(21)27-3/h4-13,15H,14,24H2,1-3H3,(H,25,26)/b12-11-,19-16- |
| InChIKey | LKAGUVUZTHMEEI-BEESYLKCSA-N |
| XLogP | 4.25 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|