C16H20F2N2O2 — CID 89148231
(E,2Z)-2-(1-aminoethylidene)-4-fluoro-N-[(2-fluoro-3-methoxyphenyl)methyl]hex-3-enamide (PubChem CID 89148231) has the molecular formula C16H20F2N2O2 and a molecular weight of 310.34 g/mol. Its IUPAC name is (E,2Z)-2-(1-aminoethylidene)-4-fluoro-N-[(2-fluoro-3-methoxyphenyl)methyl]hex-3-enamide.
| Compound Name | (E,2Z)-2-(1-aminoethylidene)-4-fluoro-N-[(2-fluoro-3-methoxyphenyl)methyl]hex-3-enamide |
|---|---|
| PubChem CID | 89148231 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (E,2Z)-2-(1-aminoethylidene)-4-fluoro-N-[(2-fluoro-3-methoxyphenyl)methyl]hex-3-enamide |
| SMILES | CC/C(F)=C\C(C(=O)NCc1cccc(OC)c1F)=C(/C)N |
| InChI | InChI=1S/C16H20F2N2O2/c1-4-12(17)8-13(10(2)19)16(21)20-9-11-6-5-7-14(22-3)15(11)18/h5-8H,4,9,19H2,1-3H3,(H,20,21)/b12-8+,13-10- |
| InChIKey | LEYHCNBQWPKIJA-LSCZQMSZSA-N |
| XLogP | 2.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|