C20H27F2N3O2 — CID 155454868
4-[(2E,4E)-3-fluorohepta-2,4-dien-4-yl]-N-[(2-fluoro-3-methoxyphenyl)methyl]piperazine-1-carboxamide (PubChem CID 155454868) has the molecular formula C20H27F2N3O2 and a molecular weight of 379.45 g/mol. Its IUPAC name is 4-[(2E,4E)-3-fluorohepta-2,4-dien-4-yl]-N-[(2-fluoro-3-methoxyphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-[(2E,4E)-3-fluorohepta-2,4-dien-4-yl]-N-[(2-fluoro-3-methoxyphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 155454868 |
| Molecular Formula | C20H27F2N3O2 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 4-[(2E,4E)-3-fluorohepta-2,4-dien-4-yl]-N-[(2-fluoro-3-methoxyphenyl)methyl]piperazine-1-carboxamide |
| SMILES | C/C=C(F)\C(=C/CC)N1CCN(C(=O)NCc2cccc(OC)c2F)CC1 |
| InChI | InChI=1S/C20H27F2N3O2/c1-4-7-17(16(21)5-2)24-10-12-25(13-11-24)20(26)23-14-15-8-6-9-18(27-3)19(15)22/h5-9H,4,10-14H2,1-3H3,(H,23,26)/b16-5+,17-7+ |
| InChIKey | PTUPVHNSSVEVCY-UXWJTHQMSA-N |
| XLogP | 3.83 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|