C19H27FN2O2 — CID 89148230
(Z,2Z)-2-(1-aminoethylidene)-N-[(3-butoxy-2-fluorophenyl)methyl]hex-3-enamide (PubChem CID 89148230) has the molecular formula C19H27FN2O2 and a molecular weight of 334.44 g/mol. Its IUPAC name is (Z,2Z)-2-(1-aminoethylidene)-N-[(3-butoxy-2-fluorophenyl)methyl]hex-3-enamide.
| Compound Name | (Z,2Z)-2-(1-aminoethylidene)-N-[(3-butoxy-2-fluorophenyl)methyl]hex-3-enamide |
|---|---|
| PubChem CID | 89148230 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (Z,2Z)-2-(1-aminoethylidene)-N-[(3-butoxy-2-fluorophenyl)methyl]hex-3-enamide |
| SMILES | CC/C=C\C(C(=O)NCc1cccc(OCCCC)c1F)=C(/C)N |
| InChI | InChI=1S/C19H27FN2O2/c1-4-6-10-16(14(3)21)19(23)22-13-15-9-8-11-17(18(15)20)24-12-7-5-2/h6,8-11H,4-5,7,12-13,21H2,1-3H3,(H,22,23)/b10-6-,16-14- |
| InChIKey | YGBBBYISKGIULF-GTYXCAGBSA-N |
| XLogP | 3.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|