C22H25ClN2O2 — CID 89148209
(Z,2Z)-2-(1-aminoethylidene)-N-[[4-[(3-chlorophenyl)methoxy]phenyl]methyl]hex-3-enamide (PubChem CID 89148209) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is (Z,2Z)-2-(1-aminoethylidene)-N-[[4-[(3-chlorophenyl)methoxy]phenyl]methyl]hex-3-enamide.
| Compound Name | (Z,2Z)-2-(1-aminoethylidene)-N-[[4-[(3-chlorophenyl)methoxy]phenyl]methyl]hex-3-enamide |
|---|---|
| PubChem CID | 89148209 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (Z,2Z)-2-(1-aminoethylidene)-N-[[4-[(3-chlorophenyl)methoxy]phenyl]methyl]hex-3-enamide |
| SMILES | CC/C=C\C(C(=O)NCc1ccc(OCc2cccc(Cl)c2)cc1)=C(/C)N |
| InChI | InChI=1S/C22H25ClN2O2/c1-3-4-8-21(16(2)24)22(26)25-14-17-9-11-20(12-10-17)27-15-18-6-5-7-19(23)13-18/h4-13H,3,14-15,24H2,1-2H3,(H,25,26)/b8-4-,21-16- |
| InChIKey | ZWNILPBFRQGTBY-GBMCKJJHSA-N |
| XLogP | 4.73 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|