C18H21ClN2O2 — CID 22421197
2-amino-3-[4-[(3-chlorophenyl)methoxy]phenyl]-N,2-dimethylpropanamide (PubChem CID 22421197) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is 2-amino-3-[4-[(3-chlorophenyl)methoxy]phenyl]-N,2-dimethylpropanamide.
| Compound Name | 2-amino-3-[4-[(3-chlorophenyl)methoxy]phenyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 22421197 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-amino-3-[4-[(3-chlorophenyl)methoxy]phenyl]-N,2-dimethylpropanamide |
| SMILES | CNC(=O)C(C)(N)Cc1ccc(OCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H21ClN2O2/c1-18(20,17(22)21-2)11-13-6-8-16(9-7-13)23-12-14-4-3-5-15(19)10-14/h3-10H,11-12,20H2,1-2H3,(H,21,22) |
| InChIKey | BUSGEXYNNDRYHC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |