C17H20Cl2N2O2 — CID 139767883
2-[[4-[(3-chlorophenyl)methoxy]phenyl]methylamino]-N-methylacetamide;hydrochloride (PubChem CID 139767883) has the molecular formula C17H20Cl2N2O2 and a molecular weight of 355.27 g/mol. Its IUPAC name is 2-[[4-[(3-chlorophenyl)methoxy]phenyl]methylamino]-N-methylacetamide;hydrochloride.
| Compound Name | 2-[[4-[(3-chlorophenyl)methoxy]phenyl]methylamino]-N-methylacetamide;hydrochloride |
|---|---|
| PubChem CID | 139767883 |
| Molecular Formula | C17H20Cl2N2O2 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-[[4-[(3-chlorophenyl)methoxy]phenyl]methylamino]-N-methylacetamide;hydrochloride |
| SMILES | CNC(=O)CNCc1ccc(OCc2cccc(Cl)c2)cc1.Cl |
| InChI | InChI=1S/C17H19ClN2O2.ClH/c1-19-17(21)11-20-10-13-5-7-16(8-6-13)22-12-14-3-2-4-15(18)9-14;/h2-9,20H,10-12H2,1H3,(H,19,21);1H |
| InChIKey | ICDCSMNLNHQFMB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |