C31H40ClN3O2 — CID 142866540
(E)-3-[amino-[(5Z,6Z)-5-ethylidene-4-methylnona-6,8-dien-2-yl]amino]-N-[[3-(4-chlorophenoxy)phenyl]methyl]-2-methylpent-2-enamide (PubChem CID 142866540) has the molecular formula C31H40ClN3O2 and a molecular weight of 522.13 g/mol. Its IUPAC name is (E)-3-[amino-[(5Z,6Z)-5-ethylidene-4-methylnona-6,8-dien-2-yl]amino]-N-[[3-(4-chlorophenoxy)phenyl]methyl]-2-methylpent-2-enamide.
| Compound Name | (E)-3-[amino-[(5Z,6Z)-5-ethylidene-4-methylnona-6,8-dien-2-yl]amino]-N-[[3-(4-chlorophenoxy)phenyl]methyl]-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 142866540 |
| Molecular Formula | C31H40ClN3O2 |
| Molecular Weight | 522.13 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | (E)-3-[amino-[(5Z,6Z)-5-ethylidene-4-methylnona-6,8-dien-2-yl]amino]-N-[[3-(4-chlorophenoxy)phenyl]methyl]-2-methylpent-2-enamide |
| SMILES | C=C/C=C\C(=C/C)C(C)CC(C)N(N)/C(CC)=C(\C)C(=O)NCc1cccc(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C31H40ClN3O2/c1-7-10-13-26(8-2)22(4)19-23(5)35(33)30(9-3)24(6)31(36)34-21-25-12-11-14-29(20-25)37-28-17-15-27(32)16-18-28/h7-8,10-18,20,22-23H,1,9,19,21,33H2,2-6H3,(H,34,36)/b13-10-,26-8+,30-24+ |
| InChIKey | YKRNKLJAIVDBNR-PXGFKWFMSA-N |
| XLogP | 7.71 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.13 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|