C17H17ClNO5P-2 — CID 91935111
N-[3-[3-(4-chlorophenoxy)phenyl]propyl]-2-phosphonatoacetamide (PubChem CID 91935111) has the molecular formula C17H17ClNO5P-2 and a molecular weight of 381.75 g/mol. Its IUPAC name is N-[3-[3-(4-chlorophenoxy)phenyl]propyl]-2-phosphonatoacetamide.
| Compound Name | N-[3-[3-(4-chlorophenoxy)phenyl]propyl]-2-phosphonatoacetamide |
|---|---|
| PubChem CID | 91935111 |
| Molecular Formula | C17H17ClNO5P-2 |
| Molecular Weight | 381.75 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | N-[3-[3-(4-chlorophenoxy)phenyl]propyl]-2-phosphonatoacetamide |
| SMILES | O=C(CP(=O)([O-])[O-])NCCCc1cccc(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H19ClNO5P/c18-14-6-8-15(9-7-14)24-16-5-1-3-13(11-16)4-2-10-19-17(20)12-25(21,22)23/h1,3,5-9,11H,2,4,10,12H2,(H,19,20)(H2,21,22,23)/p-2 |
| InChIKey | ZMUAKKRAIGELBC-UHFFFAOYSA-L |
| XLogP | 2.09 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.75 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|