C17H17ClK2NO5P — CID 58062257
dipotassium;N-[3-[3-(4-chlorophenoxy)phenyl]propyl]-2-phosphonatoacetamide (PubChem CID 58062257) has the molecular formula C17H17ClK2NO5P and a molecular weight of 459.95 g/mol. Its IUPAC name is dipotassium;N-[3-[3-(4-chlorophenoxy)phenyl]propyl]-2-phosphonatoacetamide.
| Compound Name | dipotassium;N-[3-[3-(4-chlorophenoxy)phenyl]propyl]-2-phosphonatoacetamide |
|---|---|
| PubChem CID | 58062257 |
| Molecular Formula | C17H17ClK2NO5P |
| Molecular Weight | 459.95 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | dipotassium;N-[3-[3-(4-chlorophenoxy)phenyl]propyl]-2-phosphonatoacetamide |
| SMILES | O=C(CP(=O)([O-])[O-])NCCCc1cccc(Oc2ccc(Cl)cc2)c1.[K+].[K+] |
| InChI | InChI=1S/C17H19ClNO5P.2K/c18-14-6-8-15(9-7-14)24-16-5-1-3-13(11-16)4-2-10-19-17(20)12-25(21,22)23;;/h1,3,5-9,11H,2,4,10,12H2,(H,19,20)(H2,21,22,23);;/q;2*+1/p-2 |
| InChIKey | NFAIEJMZDIAUEY-UHFFFAOYSA-L |
| XLogP | -3.90 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.95 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|