C18H21N2O6P — CID 66680025
[1-amino-1,3-dioxo-3-[3-(3-phenoxyphenyl)propylamino]propan-2-yl]phosphonic acid (PubChem CID 66680025) has the molecular formula C18H21N2O6P and a molecular weight of 392.35 g/mol. Its IUPAC name is [1-amino-1,3-dioxo-3-[3-(3-phenoxyphenyl)propylamino]propan-2-yl]phosphonic acid.
| Compound Name | [1-amino-1,3-dioxo-3-[3-(3-phenoxyphenyl)propylamino]propan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 66680025 |
| Molecular Formula | C18H21N2O6P |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [1-amino-1,3-dioxo-3-[3-(3-phenoxyphenyl)propylamino]propan-2-yl]phosphonic acid |
| SMILES | NC(=O)C(C(=O)NCCCc1cccc(Oc2ccccc2)c1)P(=O)(O)O |
| InChI | InChI=1S/C18H21N2O6P/c19-17(21)16(27(23,24)25)18(22)20-11-5-7-13-6-4-10-15(12-13)26-14-8-2-1-3-9-14/h1-4,6,8-10,12,16H,5,7,11H2,(H2,19,21)(H,20,22)(H2,23,24,25) |
| InChIKey | YSMVLEVYLICPIF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|