C25H30N2O2S — CID 143856471
(2Z,3Z)-2-(1-aminoethylidene)-N-[[4-(4-methoxyphenyl)sulfanylphenyl]methyl]-6-methylocta-3,5-dienamide (PubChem CID 143856471) has the molecular formula C25H30N2O2S and a molecular weight of 422.59 g/mol. Its IUPAC name is (2Z,3Z)-2-(1-aminoethylidene)-N-[[4-(4-methoxyphenyl)sulfanylphenyl]methyl]-6-methylocta-3,5-dienamide.
| Compound Name | (2Z,3Z)-2-(1-aminoethylidene)-N-[[4-(4-methoxyphenyl)sulfanylphenyl]methyl]-6-methylocta-3,5-dienamide |
|---|---|
| PubChem CID | 143856471 |
| Molecular Formula | C25H30N2O2S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (2Z,3Z)-2-(1-aminoethylidene)-N-[[4-(4-methoxyphenyl)sulfanylphenyl]methyl]-6-methylocta-3,5-dienamide |
| SMILES | CCC(C)=C/C=C\C(C(=O)NCc1ccc(Sc2ccc(OC)cc2)cc1)=C(/C)N |
| InChI | InChI=1S/C25H30N2O2S/c1-5-18(2)7-6-8-24(19(3)26)25(28)27-17-20-9-13-22(14-10-20)30-23-15-11-21(29-4)12-16-23/h6-16H,5,17,26H2,1-4H3,(H,27,28)/b8-6-,18-7?,24-19- |
| InChIKey | YPAMXRHOHSUXFK-FWTYPWBYSA-N |
| XLogP | 5.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|