C23H28N2O — CID 89148105
(Z,2Z)-2-(1-aminoethylidene)-N-[(4-benzylphenyl)methyl]-5-methylhex-3-enamide (PubChem CID 89148105) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is (Z,2Z)-2-(1-aminoethylidene)-N-[(4-benzylphenyl)methyl]-5-methylhex-3-enamide.
| Compound Name | (Z,2Z)-2-(1-aminoethylidene)-N-[(4-benzylphenyl)methyl]-5-methylhex-3-enamide |
|---|---|
| PubChem CID | 89148105 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (Z,2Z)-2-(1-aminoethylidene)-N-[(4-benzylphenyl)methyl]-5-methylhex-3-enamide |
| SMILES | C/C(N)=C(\C=C/C(C)C)C(=O)NCc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H28N2O/c1-17(2)9-14-22(18(3)24)23(26)25-16-21-12-10-20(11-13-21)15-19-7-5-4-6-8-19/h4-14,17H,15-16,24H2,1-3H3,(H,25,26)/b14-9-,22-18- |
| InChIKey | MYJGDEISHYZPDX-FJTDYCCXSA-N |
| XLogP | 4.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|