C12H16N2O3 — CID 6593599
N-benzyl-N'-[(2S)-2-hydroxypropyl]oxamide (PubChem CID 6593599) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is N-benzyl-N'-[(2S)-2-hydroxypropyl]oxamide.
| Compound Name | N-benzyl-N'-[(2S)-2-hydroxypropyl]oxamide |
|---|---|
| PubChem CID | 6593599 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | N-benzyl-N'-[(2S)-2-hydroxypropyl]oxamide |
| SMILES | C[C@H](O)CNC(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C12H16N2O3/c1-9(15)7-13-11(16)12(17)14-8-10-5-3-2-4-6-10/h2-6,9,15H,7-8H2,1H3,(H,13,16)(H,14,17)/t9-/m0/s1 |
| InChIKey | XJZSNABHFGBXJT-VIFPVBQESA-N |
| XLogP | -0.20 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|