C12H15ClN2O3 — CID 51471613
N-[(2-chlorophenyl)methyl]-N'-[(2R)-2-hydroxypropyl]oxamide (PubChem CID 51471613) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N'-[(2R)-2-hydroxypropyl]oxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N'-[(2R)-2-hydroxypropyl]oxamide |
|---|---|
| PubChem CID | 51471613 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N'-[(2R)-2-hydroxypropyl]oxamide |
| SMILES | C[C@@H](O)CNC(=O)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C12H15ClN2O3/c1-8(16)6-14-11(17)12(18)15-7-9-4-2-3-5-10(9)13/h2-5,8,16H,6-7H2,1H3,(H,14,17)(H,15,18)/t8-/m1/s1 |
| InChIKey | CCHZJCWMOBIHAG-MRVPVSSYSA-N |
| XLogP | 0.45 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|