C25H27F3N2O3 — CID 143856449
(2Z,3Z)-2-(1-aminoethylidene)-6-methyl-N-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]octa-3,5-dienamide (PubChem CID 143856449) has the molecular formula C25H27F3N2O3 and a molecular weight of 460.50 g/mol. Its IUPAC name is (2Z,3Z)-2-(1-aminoethylidene)-6-methyl-N-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]octa-3,5-dienamide.
| Compound Name | (2Z,3Z)-2-(1-aminoethylidene)-6-methyl-N-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]octa-3,5-dienamide |
|---|---|
| PubChem CID | 143856449 |
| Molecular Formula | C25H27F3N2O3 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | (2Z,3Z)-2-(1-aminoethylidene)-6-methyl-N-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]octa-3,5-dienamide |
| SMILES | CCC(C)=C/C=C\C(C(=O)NCc1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1)=C(/C)N |
| InChI | InChI=1S/C25H27F3N2O3/c1-4-17(2)6-5-7-23(18(3)29)24(31)30-16-19-8-10-20(11-9-19)32-21-12-14-22(15-13-21)33-25(26,27)28/h5-15H,4,16,29H2,1-3H3,(H,30,31)/b7-5-,17-6?,23-18- |
| InChIKey | KZZUSTZEPZACJN-HDQVETCESA-N |
| XLogP | 6.14 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|