C16H20N2O5S — CID 142029496
2-amino-3-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonyl-N-hydroxy-2-methylpropanamide (PubChem CID 142029496) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-amino-3-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonyl-N-hydroxy-2-methylpropanamide.
| Compound Name | 2-amino-3-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonyl-N-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 142029496 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-amino-3-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonyl-N-hydroxy-2-methylpropanamide |
| SMILES | C=C/C=C(\C=C)Oc1ccc(S(=O)(=O)CC(C)(N)C(=O)NO)cc1 |
| InChI | InChI=1S/C16H20N2O5S/c1-4-6-12(5-2)23-13-7-9-14(10-8-13)24(21,22)11-16(3,17)15(19)18-20/h4-10,20H,1-2,11,17H2,3H3,(H,18,19)/b12-6+ |
| InChIKey | MXAFCNGJTLGTSM-WUXMJOGZSA-N |
| XLogP | 1.32 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|