C12H11HfO2- — CID 170755983
hafnium;4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene-6-id-1-ol (PubChem CID 170755983) has the molecular formula C12H11HfO2- and a molecular weight of 365.71 g/mol. Its IUPAC name is hafnium;4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene-6-id-1-ol.
| Compound Name | hafnium;4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene-6-id-1-ol |
|---|---|
| PubChem CID | 170755983 |
| Molecular Formula | C12H11HfO2- |
| Molecular Weight | 365.71 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | hafnium;4-[(3E)-hexa-1,3,5-trien-3-yl]oxybenzene-6-id-1-ol |
| SMILES | C=C/C=C(\C=C)Oc1c[c-]c(O)cc1.[Hf] |
| InChI | InChI=1S/C12H11O2.Hf/c1-3-5-11(4-2)14-12-8-6-10(13)7-9-12;/h3-6,8-9,13H,1-2H2;/q-1;/b11-5+; |
| InChIKey | GPZIASRBDIVWBU-HMXKFKBXSA-N |
| XLogP | 2.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|