C14H16O2 — CID 143729565
1-[(3E)-hexa-1,3,5-trien-3-yl]oxy-3-(methoxymethyl)benzene (PubChem CID 143729565) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-[(3E)-hexa-1,3,5-trien-3-yl]oxy-3-(methoxymethyl)benzene.
| Compound Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]oxy-3-(methoxymethyl)benzene |
|---|---|
| PubChem CID | 143729565 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]oxy-3-(methoxymethyl)benzene |
| SMILES | C=C/C=C(\C=C)Oc1cccc(COC)c1 |
| InChI | InChI=1S/C14H16O2/c1-4-7-13(5-2)16-14-9-6-8-12(10-14)11-15-3/h4-10H,1-2,11H2,3H3/b13-7+ |
| InChIKey | LLBAZMCNRZDMKS-NTUHNPAUSA-N |
| XLogP | 3.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|