C17H23NO2 — CID 167461201
3-[2-[3-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]ethylamino]propan-1-ol (PubChem CID 167461201) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-[2-[3-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]ethylamino]propan-1-ol.
| Compound Name | 3-[2-[3-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 167461201 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-[2-[3-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]ethylamino]propan-1-ol |
| SMILES | C=C/C=C(\C=C)Oc1cccc(CCNCCCO)c1 |
| InChI | InChI=1S/C17H23NO2/c1-3-7-16(4-2)20-17-9-5-8-15(14-17)10-12-18-11-6-13-19/h3-5,7-9,14,18-19H,1-2,6,10-13H2/b16-7+ |
| InChIKey | MQCNBVAFHHXOLP-FRKPEAEDSA-N |
| XLogP | 2.84 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|