C23H23F2N3O — CID 89318595
(1Z,3E)-3-[3-[[2-(6,7-difluoro-1H-indol-3-yl)ethylamino]methyl]phenoxy]hexa-1,3,5-trien-1-amine (PubChem CID 89318595) has the molecular formula C23H23F2N3O and a molecular weight of 395.45 g/mol. Its IUPAC name is (1Z,3E)-3-[3-[[2-(6,7-difluoro-1H-indol-3-yl)ethylamino]methyl]phenoxy]hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-3-[3-[[2-(6,7-difluoro-1H-indol-3-yl)ethylamino]methyl]phenoxy]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89318595 |
| Molecular Formula | C23H23F2N3O |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (1Z,3E)-3-[3-[[2-(6,7-difluoro-1H-indol-3-yl)ethylamino]methyl]phenoxy]hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/N)Oc1cccc(CNCCc2c[nH]c3c(F)c(F)ccc23)c1 |
| InChI | InChI=1S/C23H23F2N3O/c1-2-4-18(9-11-26)29-19-6-3-5-16(13-19)14-27-12-10-17-15-28-23-20(17)7-8-21(24)22(23)25/h2-9,11,13,15,27-28H,1,10,12,14,26H2/b11-9-,18-4+ |
| InChIKey | GEMOGWHAWWNECV-RCLSGBNXSA-N |
| XLogP | 4.70 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|