C20H19F3N2O3 — CID 21071648
3-[2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylamino]ethyl]-1H-indole-6-carboxylic acid (PubChem CID 21071648) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is 3-[2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylamino]ethyl]-1H-indole-6-carboxylic acid.
| Compound Name | 3-[2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylamino]ethyl]-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 21071648 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 3-[2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylamino]ethyl]-1H-indole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(CCNCc3cccc(OCC(F)(F)F)c3)c[nH]c2c1 |
| InChI | InChI=1S/C20H19F3N2O3/c21-20(22,23)12-28-16-3-1-2-13(8-16)10-24-7-6-15-11-25-18-9-14(19(26)27)4-5-17(15)18/h1-5,8-9,11,24-25H,6-7,10,12H2,(H,26,27) |
| InChIKey | VHAQRNICMQDRDX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|