C23H25F5N2O — CID 87916652
N-[[3-(2,2,3,3,3-pentafluoropropoxy)phenyl]methyl]-2-(5-propan-2-yl-1H-indol-3-yl)ethanamine (PubChem CID 87916652) has the molecular formula C23H25F5N2O and a molecular weight of 440.46 g/mol. Its IUPAC name is N-[[3-(2,2,3,3,3-pentafluoropropoxy)phenyl]methyl]-2-(5-propan-2-yl-1H-indol-3-yl)ethanamine.
| Compound Name | N-[[3-(2,2,3,3,3-pentafluoropropoxy)phenyl]methyl]-2-(5-propan-2-yl-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 87916652 |
| Molecular Formula | C23H25F5N2O |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-[[3-(2,2,3,3,3-pentafluoropropoxy)phenyl]methyl]-2-(5-propan-2-yl-1H-indol-3-yl)ethanamine |
| SMILES | CC(C)c1ccc2[nH]cc(CCNCc3cccc(OCC(F)(F)C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C23H25F5N2O/c1-15(2)17-6-7-21-20(11-17)18(13-30-21)8-9-29-12-16-4-3-5-19(10-16)31-14-22(24,25)23(26,27)28/h3-7,10-11,13,15,29-30H,8-9,12,14H2,1-2H3 |
| InChIKey | KJHUACMENSOIET-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|