C23H24F4N2O3 — CID 87916602
ethyl 3-[2-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methylamino]ethyl]-1H-indole-5-carboxylate (PubChem CID 87916602) has the molecular formula C23H24F4N2O3 and a molecular weight of 452.45 g/mol. Its IUPAC name is ethyl 3-[2-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methylamino]ethyl]-1H-indole-5-carboxylate.
| Compound Name | ethyl 3-[2-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methylamino]ethyl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 87916602 |
| Molecular Formula | C23H24F4N2O3 |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | ethyl 3-[2-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methylamino]ethyl]-1H-indole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2[nH]cc(CCNCc3cccc(OCC(F)(F)C(F)F)c3)c2c1 |
| InChI | InChI=1S/C23H24F4N2O3/c1-2-31-21(30)16-6-7-20-19(11-16)17(13-29-20)8-9-28-12-15-4-3-5-18(10-15)32-14-23(26,27)22(24)25/h3-7,10-11,13,22,28-29H,2,8-9,12,14H2,1H3 |
| InChIKey | WUPVEXLWAXSJCM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|