C20H21F4N3O — CID 87916629
3-[2-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methylamino]ethyl]-1H-indol-5-amine (PubChem CID 87916629) has the molecular formula C20H21F4N3O and a molecular weight of 395.40 g/mol. Its IUPAC name is 3-[2-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methylamino]ethyl]-1H-indol-5-amine.
| Compound Name | 3-[2-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methylamino]ethyl]-1H-indol-5-amine |
|---|---|
| PubChem CID | 87916629 |
| Molecular Formula | C20H21F4N3O |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-[2-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methylamino]ethyl]-1H-indol-5-amine |
| SMILES | Nc1ccc2[nH]cc(CCNCc3cccc(OCC(F)(F)C(F)F)c3)c2c1 |
| InChI | InChI=1S/C20H21F4N3O/c21-19(22)20(23,24)12-28-16-3-1-2-13(8-16)10-26-7-6-14-11-27-18-5-4-15(25)9-17(14)18/h1-5,8-9,11,19,26-27H,6-7,10,12,25H2 |
| InChIKey | RXTWRFNAIXPAJQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|