C26H22F6N2O3S — CID 42633042
2-[6-fluoro-1-(4-fluorophenyl)sulfonylindol-3-yl]-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine (PubChem CID 42633042) has the molecular formula C26H22F6N2O3S and a molecular weight of 556.53 g/mol. Its IUPAC name is 2-[6-fluoro-1-(4-fluorophenyl)sulfonylindol-3-yl]-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine.
| Compound Name | 2-[6-fluoro-1-(4-fluorophenyl)sulfonylindol-3-yl]-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 42633042 |
| Molecular Formula | C26H22F6N2O3S |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 2-[6-fluoro-1-(4-fluorophenyl)sulfonylindol-3-yl]-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine |
| SMILES | O=S(=O)(c1ccc(F)cc1)n1cc(CCNCc2cccc(OCC(F)(F)C(F)F)c2)c2ccc(F)cc21 |
| InChI | InChI=1S/C26H22F6N2O3S/c27-19-4-7-22(8-5-19)38(35,36)34-15-18(23-9-6-20(28)13-24(23)34)10-11-33-14-17-2-1-3-21(12-17)37-16-26(31,32)25(29)30/h1-9,12-13,15,25,33H,10-11,14,16H2 |
| InChIKey | ZSIHHUHLLRHXRH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|