C23H26F5N3O — CID 162606466
2-[1-(ethylaminomethyl)-6-fluoroindol-3-yl]-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine (PubChem CID 162606466) has the molecular formula C23H26F5N3O and a molecular weight of 455.47 g/mol. Its IUPAC name is 2-[1-(ethylaminomethyl)-6-fluoroindol-3-yl]-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine.
| Compound Name | 2-[1-(ethylaminomethyl)-6-fluoroindol-3-yl]-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 162606466 |
| Molecular Formula | C23H26F5N3O |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2-[1-(ethylaminomethyl)-6-fluoroindol-3-yl]-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine |
| SMILES | CCNCn1cc(CCNCc2cccc(OCC(F)(F)C(F)F)c2)c2ccc(F)cc21 |
| InChI | InChI=1S/C23H26F5N3O/c1-2-29-15-31-13-17(20-7-6-18(24)11-21(20)31)8-9-30-12-16-4-3-5-19(10-16)32-14-23(27,28)22(25)26/h3-7,10-11,13,22,29-30H,2,8-9,12,14-15H2,1H3 |
| InChIKey | DNHAURSRTRUHTJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|