C26H22BF5N2O3S — CID 87152642
CID 87152642 (PubChem CID 87152642) has the molecular formula C26H22BF5N2O3S and a molecular weight of 548.34 g/mol.
| Compound Name | CID 87152642 |
|---|---|
| PubChem CID | 87152642 |
| Molecular Formula | C26H22BF5N2O3S |
| Molecular Weight | 548.34 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(S(=O)(=O)n2cc(CCNCc3cccc(OCC(F)(F)C(F)F)c3)c3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C26H22BF5N2O3S/c27-19-4-7-22(8-5-19)38(35,36)34-15-18(23-9-6-20(28)13-24(23)34)10-11-33-14-17-2-1-3-21(12-17)37-16-26(31,32)25(29)30/h1-9,12-13,15,25,33H,10-11,14,16H2 |
| InChIKey | HUJPWHITOFFAJZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|