C22H24F5N2O3S+ — CID 59526589
2-(1-ethylsulfonyl-6-fluoroindol-3-yl)ethyl-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]azanium (PubChem CID 59526589) has the molecular formula C22H24F5N2O3S+ and a molecular weight of 491.50 g/mol. Its IUPAC name is 2-(1-ethylsulfonyl-6-fluoroindol-3-yl)ethyl-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]azanium.
| Compound Name | 2-(1-ethylsulfonyl-6-fluoroindol-3-yl)ethyl-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 59526589 |
| Molecular Formula | C22H24F5N2O3S+ |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 2-(1-ethylsulfonyl-6-fluoroindol-3-yl)ethyl-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]azanium |
| SMILES | CCS(=O)(=O)n1cc(CC[NH2+]Cc2cccc(OCC(F)(F)C(F)F)c2)c2ccc(F)cc21 |
| InChI | InChI=1S/C22H23F5N2O3S/c1-2-33(30,31)29-13-16(19-7-6-17(23)11-20(19)29)8-9-28-12-15-4-3-5-18(10-15)32-14-22(26,27)21(24)25/h3-7,10-11,13,21,28H,2,8-9,12,14H2,1H3/p+1 |
| InChIKey | YYTOVJASBQPWSJ-UHFFFAOYSA-O |
| XLogP | 3.56 |
| TPSA | 64.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|