C26H21ClF6N2O3S — CID 42633224
2-[1-(3-chloro-4-fluorophenyl)sulfonyl-6-fluoroindol-3-yl]-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine (PubChem CID 42633224) has the molecular formula C26H21ClF6N2O3S and a molecular weight of 590.97 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-fluorophenyl)sulfonyl-6-fluoroindol-3-yl]-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine.
| Compound Name | 2-[1-(3-chloro-4-fluorophenyl)sulfonyl-6-fluoroindol-3-yl]-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 42633224 |
| Molecular Formula | C26H21ClF6N2O3S |
| Molecular Weight | 590.97 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | 2-[1-(3-chloro-4-fluorophenyl)sulfonyl-6-fluoroindol-3-yl]-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine |
| SMILES | O=S(=O)(c1ccc(F)c(Cl)c1)n1cc(CCNCc2cccc(OCC(F)(F)C(F)F)c2)c2ccc(F)cc21 |
| InChI | InChI=1S/C26H21ClF6N2O3S/c27-22-12-20(5-7-23(22)29)39(36,37)35-14-17(21-6-4-18(28)11-24(21)35)8-9-34-13-16-2-1-3-19(10-16)38-15-26(32,33)25(30)31/h1-7,10-12,14,25,34H,8-9,13,15H2 |
| InChIKey | HERLLFWIHKJPQF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.97 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|