C21H19F4N3O — CID 87916611
3-[2-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methylamino]ethyl]-1H-indole-7-carbonitrile (PubChem CID 87916611) has the molecular formula C21H19F4N3O and a molecular weight of 405.40 g/mol. Its IUPAC name is 3-[2-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methylamino]ethyl]-1H-indole-7-carbonitrile.
| Compound Name | 3-[2-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methylamino]ethyl]-1H-indole-7-carbonitrile |
|---|---|
| PubChem CID | 87916611 |
| Molecular Formula | C21H19F4N3O |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 3-[2-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methylamino]ethyl]-1H-indole-7-carbonitrile |
| SMILES | N#Cc1cccc2c(CCNCc3cccc(OCC(F)(F)C(F)F)c3)c[nH]c12 |
| InChI | InChI=1S/C21H19F4N3O/c22-20(23)21(24,25)13-29-17-5-1-3-14(9-17)11-27-8-7-16-12-28-19-15(10-26)4-2-6-18(16)19/h1-6,9,12,20,27-28H,7-8,11,13H2 |
| InChIKey | QGWPMPLEYQJDDZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 60.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|