C26H24F4N2O — CID 87916674
2-(5-phenyl-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine (PubChem CID 87916674) has the molecular formula C26H24F4N2O and a molecular weight of 456.48 g/mol. Its IUPAC name is 2-(5-phenyl-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine.
| Compound Name | 2-(5-phenyl-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 87916674 |
| Molecular Formula | C26H24F4N2O |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-(5-phenyl-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine |
| SMILES | FC(F)C(F)(F)COc1cccc(CNCCc2c[nH]c3ccc(-c4ccccc4)cc23)c1 |
| InChI | InChI=1S/C26H24F4N2O/c27-25(28)26(29,30)17-33-22-8-4-5-18(13-22)15-31-12-11-21-16-32-24-10-9-20(14-23(21)24)19-6-2-1-3-7-19/h1-10,13-14,16,25,31-32H,11-12,15,17H2 |
| InChIKey | GBAJRRFBCIAYLP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|