C22H24F4N2O2 — CID 21071646
N-[2-(5-propoxy-1H-indol-3-yl)ethyl]-3-(2,2,3,3-tetrafluoropropoxy)aniline (PubChem CID 21071646) has the molecular formula C22H24F4N2O2 and a molecular weight of 424.44 g/mol. Its IUPAC name is N-[2-(5-propoxy-1H-indol-3-yl)ethyl]-3-(2,2,3,3-tetrafluoropropoxy)aniline.
| Compound Name | N-[2-(5-propoxy-1H-indol-3-yl)ethyl]-3-(2,2,3,3-tetrafluoropropoxy)aniline |
|---|---|
| PubChem CID | 21071646 |
| Molecular Formula | C22H24F4N2O2 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-[2-(5-propoxy-1H-indol-3-yl)ethyl]-3-(2,2,3,3-tetrafluoropropoxy)aniline |
| SMILES | CCCOc1ccc2[nH]cc(CCNc3cccc(OCC(F)(F)C(F)F)c3)c2c1 |
| InChI | InChI=1S/C22H24F4N2O2/c1-2-10-29-18-6-7-20-19(12-18)15(13-28-20)8-9-27-16-4-3-5-17(11-16)30-14-22(25,26)21(23)24/h3-7,11-13,21,27-28H,2,8-10,14H2,1H3 |
| InChIKey | PSFMVDCMWVDZIK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|