C24H25ClN2O — CID 17295021
2-(1H-indol-3-yl)-N-[(3-phenylmethoxyphenyl)methyl]ethanamine;hydrochloride (PubChem CID 17295021) has the molecular formula C24H25ClN2O and a molecular weight of 392.93 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[(3-phenylmethoxyphenyl)methyl]ethanamine;hydrochloride.
| Compound Name | 2-(1H-indol-3-yl)-N-[(3-phenylmethoxyphenyl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17295021 |
| Molecular Formula | C24H25ClN2O |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[(3-phenylmethoxyphenyl)methyl]ethanamine;hydrochloride |
| SMILES | Cl.c1ccc(COc2cccc(CNCCc3c[nH]c4ccccc34)c2)cc1 |
| InChI | InChI=1S/C24H24N2O.ClH/c1-2-7-19(8-3-1)18-27-22-10-6-9-20(15-22)16-25-14-13-21-17-26-24-12-5-4-11-23(21)24;/h1-12,15,17,25-26H,13-14,16,18H2;1H |
| InChIKey | LZHONZGLJSQLCN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|